C10H14N2 — CID 143713059
1,5-dihydropyrrolo[2,3-b]azepine;ethane (PubChem CID 143713059) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,5-dihydropyrrolo[2,3-b]azepine;ethane.
| Compound Name | 1,5-dihydropyrrolo[2,3-b]azepine;ethane |
|---|---|
| PubChem CID | 143713059 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,5-dihydropyrrolo[2,3-b]azepine;ethane |
| SMILES | C1=CN=c2[nH]ccc2=CC1.CC |
| InChI | InChI=1S/C8H8N2.C2H6/c1-2-5-9-8-7(3-1)4-6-10-8;1-2/h2-6H,1H2,(H,9,10);1-2H3 |
| InChIKey | CJZMAVCCEAIKBP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |