C15H19ClN2 — CID 143338814
(Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide (PubChem CID 143338814) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is (Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide.
| Compound Name | (Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide |
|---|---|
| PubChem CID | 143338814 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (Z)-N-[(E)-2-chloro-3-cyclopenta-1,3-dien-1-ylprop-1-enyl]-N'-methyl-2-methylidenepent-3-enimidamide |
| SMILES | C=C(/C=C\C)/C(=N\C)N/C=C(/Cl)CC1=CC=CC1 |
| InChI | InChI=1S/C15H19ClN2/c1-4-7-12(2)15(17-3)18-11-14(16)10-13-8-5-6-9-13/h4-8,11H,2,9-10H2,1,3H3,(H,17,18)/b7-4-,14-11+ |
| InChIKey | LXDPPUTWOUSXLL-VEELRMRUSA-N |
| XLogP | 4.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|