C8H10N2 — CID 143713204
(3Z)-3-but-3-enylidenepyrrol-2-amine (PubChem CID 143713204) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (3Z)-3-but-3-enylidenepyrrol-2-amine.
| Compound Name | (3Z)-3-but-3-enylidenepyrrol-2-amine |
|---|---|
| PubChem CID | 143713204 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (3Z)-3-but-3-enylidenepyrrol-2-amine |
| SMILES | C=CC/C=C1/C=CN=C1N |
| InChI | InChI=1S/C8H10N2/c1-2-3-4-7-5-6-10-8(7)9/h2,4-6H,1,3H2,(H2,9,10)/b7-4- |
| InChIKey | LXDXTJYLAZCMNW-DAXSKMNVSA-N |
| XLogP | 1.37 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|