C16H27ClO3 — CID 143714113
(3aR,6aS)-4-[(E)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;chloromethane (PubChem CID 143714113) has the molecular formula C16H27ClO3 and a molecular weight of 302.84 g/mol. Its IUPAC name is (3aR,6aS)-4-[(E)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;chloromethane.
| Compound Name | (3aR,6aS)-4-[(E)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;chloromethane |
|---|---|
| PubChem CID | 143714113 |
| Molecular Formula | C16H27ClO3 |
| Molecular Weight | 302.84 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (3aR,6aS)-4-[(E)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one;chloromethane |
| SMILES | CCCCCC(O)/C=C/C1CC[C@@H]2OC(=O)C[C@H]12.CCl |
| InChI | InChI=1S/C15H24O3.CH3Cl/c1-2-3-4-5-12(16)8-6-11-7-9-14-13(11)10-15(17)18-14;1-2/h6,8,11-14,16H,2-5,7,9-10H2,1H3;1H3/b8-6+;/t11?,12?,13-,14+;/m1./s1 |
| InChIKey | VOXYVYBZGKHRDN-NXRQKTDYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|