C17H28O3 — CID 143714116
(3aR,6aS)-4-[(E)-3-ethyl-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 143714116) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (3aR,6aS)-4-[(E)-3-ethyl-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,6aS)-4-[(E)-3-ethyl-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 143714116 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (3aR,6aS)-4-[(E)-3-ethyl-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCC(O)(/C=C/C1CC[C@@H]2OC(=O)C[C@H]12)CC |
| InChI | InChI=1S/C17H28O3/c1-3-5-6-10-17(19,4-2)11-9-13-7-8-15-14(13)12-16(18)20-15/h9,11,13-15,19H,3-8,10,12H2,1-2H3/b11-9+/t13?,14-,15+,17?/m1/s1 |
| InChIKey | IVFOIYLAFWESRR-CWSXKAAWSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|