C16H23F3O3 — CID 70559503
(3aR,4S,6aR)-4-[1-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70559503) has the molecular formula C16H23F3O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-[1-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,6aR)-4-[1-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70559503 |
| Molecular Formula | C16H23F3O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (3aR,4S,6aR)-4-[1-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(CC=C(O)[C@H]1CC[C@H]2OC(=O)C[C@H]12)C(F)(F)F |
| InChI | InChI=1S/C16H23F3O3/c1-2-3-4-10(16(17,18)19)5-7-13(20)11-6-8-14-12(11)9-15(21)22-14/h7,10-12,14,20H,2-6,8-9H2,1H3/t10?,11-,12+,14+/m0/s1 |
| InChIKey | RKXMRLIOQQACKW-JOEFCEOISA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|