About [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate
[4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate (PubChem CID 143714574) has the molecular formula C26H29O4P
and a molecular weight of 436.49 g/mol. Its IUPAC name is [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate.
Molecular Properties
| Compound Name | [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate |
| PubChem CID | 143714574 |
| Molecular Formula | C26H29O4P |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)Oc2ccc(P(C)(=O)OC3C4CC5CC(C4)CC3C5)cc2)cc1 |
| InChI | InChI=1S/C26H29O4P/c1-3-17-4-6-20(7-5-17)26(27)29-23-8-10-24(11-9-23)31(2,28)30-25-21-13-18-12-19(15-21)16-22(25)14-18/h3-11,18-19,21-22,25H,1,12-16H2,2H3 |
| InChIKey | FNBOLGONNZQEHG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate?
The IUPAC name of [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate (CID 143714574) is [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate.
What is the SMILES notation for [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate?
The canonical SMILES for [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate is C=Cc1ccc(C(=O)Oc2ccc(P(C)(=O)OC3C4CC5CC(C4)CC3C5)cc2)cc1.
What is the InChIKey of [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate?
The InChIKey is FNBOLGONNZQEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29O4P/c1-3-17-4-6-20(7-5-17)26(27)29-23-8-10-24(11-9-23)31(2,28)30-25-21-13-18-12-19(15-21)16-22(25)14-18/h3-11,18-19,21-22,25H,1,12-16H2,2H3.
What are the key properties of [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate?
[4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate has a molecular weight of 436.49 g/mol, XLogP of 5.92, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-adamantyloxy(methyl)phosphoryl]phenyl] 4-ethenylbenzoate is sourced from PubChem (CID 143714574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).