C7H14IN3 — CID 143715837
4-methyl-3-(methylideneamino)-2,3-dihydropyridin-2-amine;molecular hydrogen;hydroiodide (PubChem CID 143715837) has the molecular formula C7H14IN3 and a molecular weight of 267.11 g/mol. Its IUPAC name is 4-methyl-3-(methylideneamino)-2,3-dihydropyridin-2-amine;molecular hydrogen;hydroiodide.
| Compound Name | 4-methyl-3-(methylideneamino)-2,3-dihydropyridin-2-amine;molecular hydrogen;hydroiodide |
|---|---|
| PubChem CID | 143715837 |
| Molecular Formula | C7H14IN3 |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 4-methyl-3-(methylideneamino)-2,3-dihydropyridin-2-amine;molecular hydrogen;hydroiodide |
| SMILES | C=NC1C(C)=CC=NC1N.I.[H][H] |
| InChI | InChI=1S/C7H11N3.HI.H2/c1-5-3-4-10-7(8)6(5)9-2;;/h3-4,6-7H,2,8H2,1H3;2*1H |
| InChIKey | HKCUVTBNGVNXEZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|