C9H18S — CID 143716663
5,6-dimethyl-3,4-dihydro-2H-thiopyran;ethane (PubChem CID 143716663) has the molecular formula C9H18S and a molecular weight of 158.31 g/mol. Its IUPAC name is 5,6-dimethyl-3,4-dihydro-2H-thiopyran;ethane.
| Compound Name | 5,6-dimethyl-3,4-dihydro-2H-thiopyran;ethane |
|---|---|
| PubChem CID | 143716663 |
| Molecular Formula | C9H18S |
| Molecular Weight | 158.31 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 5,6-dimethyl-3,4-dihydro-2H-thiopyran;ethane |
| SMILES | CC.CC1=C(C)SCCC1 |
| InChI | InChI=1S/C7H12S.C2H6/c1-6-4-3-5-8-7(6)2;1-2/h3-5H2,1-2H3;1-2H3 |
| InChIKey | RILXMMWHQHJWIF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |