C12H19N3O4S — CID 143717768
ethyl (2E)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]amino]hydrazinylidene]-2-thiophen-2-ylacetate (PubChem CID 143717768) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is ethyl (2E)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]amino]hydrazinylidene]-2-thiophen-2-ylacetate.
| Compound Name | ethyl (2E)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]amino]hydrazinylidene]-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 143717768 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethyl (2E)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]amino]hydrazinylidene]-2-thiophen-2-ylacetate |
| SMILES | CCOC(=O)/C(=N\NN(O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C12H19N3O4S/c1-5-18-11(16)10(9-7-6-8-20-9)13-14-15(17)19-12(2,3)4/h6-8,14,17H,5H2,1-4H3/b13-10- |
| InChIKey | ZWLIKEUHUOBUQR-RAXLEYEMSA-N |
| XLogP | 1.94 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|