C18H26N2O4S — CID 58693852
ethyl (2E)-2-[2-cyclopropylethyl-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinylidene]-2-thiophen-2-ylacetate (PubChem CID 58693852) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is ethyl (2E)-2-[2-cyclopropylethyl-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinylidene]-2-thiophen-2-ylacetate.
| Compound Name | ethyl (2E)-2-[2-cyclopropylethyl-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinylidene]-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 58693852 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl (2E)-2-[2-cyclopropylethyl-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinylidene]-2-thiophen-2-ylacetate |
| SMILES | CCOC(=O)/C(=N\N(CCC1CC1)C(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C18H26N2O4S/c1-5-23-16(21)15(14-7-6-12-25-14)19-20(11-10-13-8-9-13)17(22)24-18(2,3)4/h6-7,12-13H,5,8-11H2,1-4H3/b19-15- |
| InChIKey | IXADMIGITGSMNL-CYVLTUHYSA-N |
| XLogP | 4.05 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|