C16H20N2O3 — CID 14371810
8-benzyl-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione (PubChem CID 14371810) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 8-benzyl-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione.
| Compound Name | 8-benzyl-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 14371810 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 8-benzyl-2-methoxy-2,8-diazaspiro[4.5]decane-1,3-dione |
| SMILES | CON1C(=O)CC2(CCN(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C16H20N2O3/c1-21-18-14(19)11-16(15(18)20)7-9-17(10-8-16)12-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChIKey | OUSBHMHRADOYIY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|