C10H18N2O4 — CID 143719526
(Z)-3-[formyl-(1-hydroxy-3-methoxybutyl)amino]-N-methylprop-2-enamide (PubChem CID 143719526) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (Z)-3-[formyl-(1-hydroxy-3-methoxybutyl)amino]-N-methylprop-2-enamide.
| Compound Name | (Z)-3-[formyl-(1-hydroxy-3-methoxybutyl)amino]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 143719526 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (Z)-3-[formyl-(1-hydroxy-3-methoxybutyl)amino]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C\N(C=O)C(O)CC(C)OC |
| InChI | InChI=1S/C10H18N2O4/c1-8(16-3)6-10(15)12(7-13)5-4-9(14)11-2/h4-5,7-8,10,15H,6H2,1-3H3,(H,11,14)/b5-4- |
| InChIKey | MJYILCIRQVYXQT-PLNGDYQASA-N |
| XLogP | -0.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|