C29H37N5O4 — CID 143721000
4-[[[4-[(1S)-1-(1-benzyl-4-methylpiperidin-3-yl)propyl]-5-(methylamino)-3-nitro-2-pyridinyl]amino]methyl]benzene-1,2-diol (PubChem CID 143721000) has the molecular formula C29H37N5O4 and a molecular weight of 519.65 g/mol. Its IUPAC name is 4-[[[4-[(1S)-1-(1-benzyl-4-methylpiperidin-3-yl)propyl]-5-(methylamino)-3-nitro-2-pyridinyl]amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[4-[(1S)-1-(1-benzyl-4-methylpiperidin-3-yl)propyl]-5-(methylamino)-3-nitro-2-pyridinyl]amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 143721000 |
| Molecular Formula | C29H37N5O4 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 4-[[[4-[(1S)-1-(1-benzyl-4-methylpiperidin-3-yl)propyl]-5-(methylamino)-3-nitro-2-pyridinyl]amino]methyl]benzene-1,2-diol |
| SMILES | CC[C@H](c1c(NC)cnc(NCc2ccc(O)c(O)c2)c1[N+](=O)[O-])C1CN(Cc2ccccc2)CCC1C |
| InChI | InChI=1S/C29H37N5O4/c1-4-22(23-18-33(13-12-19(23)2)17-20-8-6-5-7-9-20)27-24(30-3)16-32-29(28(27)34(37)38)31-15-21-10-11-25(35)26(36)14-21/h5-11,14,16,19,22-23,30,35-36H,4,12-13,15,17-18H2,1-3H3,(H,31,32)/t19?,22-,23?/m0/s1 |
| InChIKey | JDIKTMFPANSCQB-UTCTYZAISA-N |
| XLogP | 5.71 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|