C30H37N5O6 — CID 68590530
ethyl 4-[[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]amino]-6-[(3,4-dimethoxyphenyl)methylamino]-5-nitropyridine-3-carboxylate (PubChem CID 68590530) has the molecular formula C30H37N5O6 and a molecular weight of 563.66 g/mol. Its IUPAC name is ethyl 4-[[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]amino]-6-[(3,4-dimethoxyphenyl)methylamino]-5-nitropyridine-3-carboxylate.
| Compound Name | ethyl 4-[[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]amino]-6-[(3,4-dimethoxyphenyl)methylamino]-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 68590530 |
| Molecular Formula | C30H37N5O6 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | ethyl 4-[[(3S,4S)-1-benzyl-4-methylpiperidin-3-yl]amino]-6-[(3,4-dimethoxyphenyl)methylamino]-5-nitropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCc2ccc(OC)c(OC)c2)c([N+](=O)[O-])c1N[C@@H]1CN(Cc2ccccc2)CC[C@@H]1C |
| InChI | InChI=1S/C30H37N5O6/c1-5-41-30(36)23-17-32-29(31-16-22-11-12-25(39-3)26(15-22)40-4)28(35(37)38)27(23)33-24-19-34(14-13-20(24)2)18-21-9-7-6-8-10-21/h6-12,15,17,20,24H,5,13-14,16,18-19H2,1-4H3,(H2,31,32,33)/t20-,24+/m0/s1 |
| InChIKey | ZNVSKCUFUQUJMY-GBXCKJPGSA-N |
| XLogP | 5.12 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|