C13H19N — CID 143722816
5-tert-butyl-5-methyl-1,6-dihydroindole (PubChem CID 143722816) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 5-tert-butyl-5-methyl-1,6-dihydroindole.
| Compound Name | 5-tert-butyl-5-methyl-1,6-dihydroindole |
|---|---|
| PubChem CID | 143722816 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 5-tert-butyl-5-methyl-1,6-dihydroindole |
| SMILES | CC(C)(C)C1(C)C=c2cc[nH]c2=CC1 |
| InChI | InChI=1S/C13H19N/c1-12(2,3)13(4)7-5-11-10(9-13)6-8-14-11/h5-6,8-9,14H,7H2,1-4H3 |
| InChIKey | NVWTZABBBAQMQJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |