C20H25ClN6OS — CID 143722899
5-chloro-N-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]-1,2-dihydrotriazol-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 143722899) has the molecular formula C20H25ClN6OS and a molecular weight of 432.98 g/mol. Its IUPAC name is 5-chloro-N-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]-1,2-dihydrotriazol-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]-1,2-dihydrotriazol-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143722899 |
| Molecular Formula | C20H25ClN6OS |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 5-chloro-N-[[3-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]-1,2-dihydrotriazol-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | CN1CCCN(c2ccc(N3C=C(CNC(=O)c4ccc(Cl)s4)NN3)cc2)CC1 |
| InChI | InChI=1S/C20H25ClN6OS/c1-25-9-2-10-26(12-11-25)16-3-5-17(6-4-16)27-14-15(23-24-27)13-22-20(28)18-7-8-19(21)29-18/h3-8,14,23-24H,2,9-13H2,1H3,(H,22,28) |
| InChIKey | NFUYSCGSJXUBRK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|