5-(methoxymethyl)-2H-tetrazole;molecular hydrogen

C3H8N4O — CID 143723114

IUPAC5-(methoxymethyl)-2H-tetrazole;molecular hydrogen
SMILESCOCc1nn[nH]n1.[H][H]
InChIInChI=1S/C3H6N4O.H2/c1-8-2-3-4-6-7-5-3;/h2H2,1H3,(H,4,5,6,7);1H
InChIKeyJIFWGCBLFUADBH-UHFFFAOYSA-N
MW116.12 g/mol
LogP-0.41
Rot. Bonds2

About 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen

5-(methoxymethyl)-2H-tetrazole;molecular hydrogen (PubChem CID 143723114) has the molecular formula C3H8N4O and a molecular weight of 116.12 g/mol. Its IUPAC name is 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen.

Molecular Properties

Compound Name5-(methoxymethyl)-2H-tetrazole;molecular hydrogen
PubChem CID143723114
Molecular FormulaC3H8N4O
Molecular Weight116.12 g/mol
Exact Mass116.07
IUPAC Name5-(methoxymethyl)-2H-tetrazole;molecular hydrogen
SMILESCOCc1nn[nH]n1.[H][H]
InChIInChI=1S/C3H6N4O.H2/c1-8-2-3-4-6-7-5-3;/h2H2,1H3,(H,4,5,6,7);1H
InChIKeyJIFWGCBLFUADBH-UHFFFAOYSA-N
XLogP-0.41
TPSA63.69 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.12
LogP ≤ 5-0.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen?
The IUPAC name of 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen (CID 143723114) is 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen.
What is the SMILES notation for 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen?
The canonical SMILES for 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen is COCc1nn[nH]n1.[H][H].
What is the InChIKey of 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen?
The InChIKey is JIFWGCBLFUADBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4O.H2/c1-8-2-3-4-6-7-5-3;/h2H2,1H3,(H,4,5,6,7);1H.
What are the key properties of 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen?
5-(methoxymethyl)-2H-tetrazole;molecular hydrogen has a molecular weight of 116.12 g/mol, XLogP of -0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-2H-tetrazole;molecular hydrogen is sourced from PubChem (CID 143723114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).