C7H12N4O3 — CID 68921663
methyl 2-methyl-2-(2H-tetrazol-5-ylmethoxy)propanoate (PubChem CID 68921663) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is methyl 2-methyl-2-(2H-tetrazol-5-ylmethoxy)propanoate.
| Compound Name | methyl 2-methyl-2-(2H-tetrazol-5-ylmethoxy)propanoate |
|---|---|
| PubChem CID | 68921663 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | methyl 2-methyl-2-(2H-tetrazol-5-ylmethoxy)propanoate |
| SMILES | COC(=O)C(C)(C)OCc1nn[nH]n1 |
| InChI | InChI=1S/C7H12N4O3/c1-7(2,6(12)13-3)14-4-5-8-10-11-9-5/h4H2,1-3H3,(H,8,9,10,11) |
| InChIKey | FZUFKXORJGWDGQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |