C9H16N4O3 — CID 144957467
(2S)-6-methoxy-2-(2H-tetrazol-5-ylmethyl)hexanoic acid (PubChem CID 144957467) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is (2S)-6-methoxy-2-(2H-tetrazol-5-ylmethyl)hexanoic acid.
| Compound Name | (2S)-6-methoxy-2-(2H-tetrazol-5-ylmethyl)hexanoic acid |
|---|---|
| PubChem CID | 144957467 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2S)-6-methoxy-2-(2H-tetrazol-5-ylmethyl)hexanoic acid |
| SMILES | COCCCC[C@@H](Cc1nn[nH]n1)C(=O)O |
| InChI | InChI=1S/C9H16N4O3/c1-16-5-3-2-4-7(9(14)15)6-8-10-12-13-11-8/h7H,2-6H2,1H3,(H,14,15)(H,10,11,12,13)/t7-/m0/s1 |
| InChIKey | TUNFSCYLJSYDSL-ZETCQYMHSA-N |
| XLogP | 0.26 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|