C19H29N5O3 — CID 144957671
4-(4-methylphenyl)piperidin-3-ol;2-(2H-tetrazol-5-ylmethyl)pentanoic acid (PubChem CID 144957671) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-(4-methylphenyl)piperidin-3-ol;2-(2H-tetrazol-5-ylmethyl)pentanoic acid.
| Compound Name | 4-(4-methylphenyl)piperidin-3-ol;2-(2H-tetrazol-5-ylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 144957671 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 4-(4-methylphenyl)piperidin-3-ol;2-(2H-tetrazol-5-ylmethyl)pentanoic acid |
| SMILES | CCCC(Cc1nn[nH]n1)C(=O)O.Cc1ccc(C2CCNCC2O)cc1 |
| InChI | InChI=1S/C12H17NO.C7H12N4O2/c1-9-2-4-10(5-3-9)11-6-7-13-8-12(11)14;1-2-3-5(7(12)13)4-6-8-10-11-9-6/h2-5,11-14H,6-8H2,1H3;5H,2-4H2,1H3,(H,12,13)(H,8,9,10,11) |
| InChIKey | XJJFDIUMBOYVBO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |