C19H30N8O2 — CID 144957587
4-(5-methyl-2-pyridinyl)piperidine-1-carboximidamide;2-(2H-tetrazol-5-ylmethyl)pentanoic acid (PubChem CID 144957587) has the molecular formula C19H30N8O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-(5-methyl-2-pyridinyl)piperidine-1-carboximidamide;2-(2H-tetrazol-5-ylmethyl)pentanoic acid.
| Compound Name | 4-(5-methyl-2-pyridinyl)piperidine-1-carboximidamide;2-(2H-tetrazol-5-ylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 144957587 |
| Molecular Formula | C19H30N8O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 4-(5-methyl-2-pyridinyl)piperidine-1-carboximidamide;2-(2H-tetrazol-5-ylmethyl)pentanoic acid |
| SMILES | CCCC(Cc1nn[nH]n1)C(=O)O.[H]/N=C(\N)N1CCC(c2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C12H18N4.C7H12N4O2/c1-9-2-3-11(15-8-9)10-4-6-16(7-5-10)12(13)14;1-2-3-5(7(12)13)4-6-8-10-11-9-6/h2-3,8,10H,4-7H2,1H3,(H3,13,14);5H,2-4H2,1H3,(H,12,13)(H,8,9,10,11) |
| InChIKey | RBVYJTDNTWFTOS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 157.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|