C21H31N7O2 — CID 129273556
(2S)-2-[(1S)-2-[4-(1-carbamimidoylpiperidin-4-yl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid (PubChem CID 129273556) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-[4-(1-carbamimidoylpiperidin-4-yl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid.
| Compound Name | (2S)-2-[(1S)-2-[4-(1-carbamimidoylpiperidin-4-yl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 129273556 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (2S)-2-[(1S)-2-[4-(1-carbamimidoylpiperidin-4-yl)phenyl]-1-(2H-tetrazol-5-yl)ethyl]hexanoic acid |
| SMILES | [H]/N=C(\N)N1CCC(c2ccc(C[C@H](c3nn[nH]n3)[C@H](CCCC)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C21H31N7O2/c1-2-3-4-17(20(29)30)18(19-24-26-27-25-19)13-14-5-7-15(8-6-14)16-9-11-28(12-10-16)21(22)23/h5-8,16-18H,2-4,9-13H2,1H3,(H3,22,23)(H,29,30)(H,24,25,26,27)/t17-,18-/m0/s1 |
| InChIKey | RBXBVXONWWGDGB-ROUUACIJSA-N |
| XLogP | 2.49 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|