C14H18BrN5O2 — CID 118498996
tert-butyl (2R)-2-[(6-bromo-3-pyridinyl)methyl]-3-(2H-tetrazol-5-yl)propanoate (PubChem CID 118498996) has the molecular formula C14H18BrN5O2 and a molecular weight of 368.24 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(6-bromo-3-pyridinyl)methyl]-3-(2H-tetrazol-5-yl)propanoate.
| Compound Name | tert-butyl (2R)-2-[(6-bromo-3-pyridinyl)methyl]-3-(2H-tetrazol-5-yl)propanoate |
|---|---|
| PubChem CID | 118498996 |
| Molecular Formula | C14H18BrN5O2 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | tert-butyl (2R)-2-[(6-bromo-3-pyridinyl)methyl]-3-(2H-tetrazol-5-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc(Br)nc1)Cc1nn[nH]n1 |
| InChI | InChI=1S/C14H18BrN5O2/c1-14(2,3)22-13(21)10(7-12-17-19-20-18-12)6-9-4-5-11(15)16-8-9/h4-5,8,10H,6-7H2,1-3H3,(H,17,18,19,20)/t10-/m1/s1 |
| InChIKey | RWIQRFDULNNKBV-SNVBAGLBSA-N |
| XLogP | 2.10 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|