C28H32BBrN2O6 — CID 91240089
tert-butyl (2S)-3-(6-bromo-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;methylboronic acid (PubChem CID 91240089) has the molecular formula C28H32BBrN2O6 and a molecular weight of 583.29 g/mol. Its IUPAC name is tert-butyl (2S)-3-(6-bromo-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;methylboronic acid.
| Compound Name | tert-butyl (2S)-3-(6-bromo-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;methylboronic acid |
|---|---|
| PubChem CID | 91240089 |
| Molecular Formula | C28H32BBrN2O6 |
| Molecular Weight | 583.29 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | tert-butyl (2S)-3-(6-bromo-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate;methylboronic acid |
| SMILES | CB(O)O.CC(C)(C)OC(=O)[C@H](Cc1ccc(Br)nc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H27BrN2O4.CH5BO2/c1-27(2,3)34-25(31)23(14-17-12-13-24(28)29-15-17)30-26(32)33-16-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22;1-2(3)4/h4-13,15,22-23H,14,16H2,1-3H3,(H,30,32);3-4H,1H3/t23-;/m0./s1 |
| InChIKey | SPSYXRHDGFXSRH-BQAIUKQQSA-N |
| XLogP | 4.72 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|