C28H30BN2O4 — CID 70321691
CID 70321691 (PubChem CID 70321691) has the molecular formula C28H30BN2O4 and a molecular weight of 469.37 g/mol.
| Compound Name | CID 70321691 |
|---|---|
| PubChem CID | 70321691 |
| Molecular Formula | C28H30BN2O4 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C28H30BN2O4/c1-28(2,3)35-26(32)24(15-18-13-14-25(29-4)30-16-18)31-27(33)34-17-23-21-11-7-5-9-19(21)20-10-6-8-12-22(20)23/h5-14,16,23-24H,15,17H2,1-4H3,(H,31,33)/t24-/m0/s1 |
| InChIKey | NJTJGLVBYHTBKT-DEOSSOPVSA-N |
| XLogP | 4.25 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|