C8H14N8O2 — CID 13101701
5-[2-[2-[2-(2H-tetrazol-5-yl)ethoxy]ethoxy]ethyl]-2H-tetrazole (PubChem CID 13101701) has the molecular formula C8H14N8O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 5-[2-[2-[2-(2H-tetrazol-5-yl)ethoxy]ethoxy]ethyl]-2H-tetrazole.
| Compound Name | 5-[2-[2-[2-(2H-tetrazol-5-yl)ethoxy]ethoxy]ethyl]-2H-tetrazole |
|---|---|
| PubChem CID | 13101701 |
| Molecular Formula | C8H14N8O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5-[2-[2-[2-(2H-tetrazol-5-yl)ethoxy]ethoxy]ethyl]-2H-tetrazole |
| SMILES | C(COCCc1nn[nH]n1)OCCc1nn[nH]n1 |
| InChI | InChI=1S/C8H14N8O2/c1(7-9-13-14-10-7)3-17-5-6-18-4-2-8-11-15-16-12-8/h1-6H2,(H,9,10,13,14)(H,11,12,15,16) |
| InChIKey | LQPDHTNPUNDHLV-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|