C17H38N6O2 — CID 142506573
N,N-diethyl-3-methylbutan-1-amine;ethane;N-methyl-2-[2-(2H-tetrazol-5-yl)ethoxy]acetamide (PubChem CID 142506573) has the molecular formula C17H38N6O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N,N-diethyl-3-methylbutan-1-amine;ethane;N-methyl-2-[2-(2H-tetrazol-5-yl)ethoxy]acetamide.
| Compound Name | N,N-diethyl-3-methylbutan-1-amine;ethane;N-methyl-2-[2-(2H-tetrazol-5-yl)ethoxy]acetamide |
|---|---|
| PubChem CID | 142506573 |
| Molecular Formula | C17H38N6O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | N,N-diethyl-3-methylbutan-1-amine;ethane;N-methyl-2-[2-(2H-tetrazol-5-yl)ethoxy]acetamide |
| SMILES | CC.CCN(CC)CCC(C)C.CNC(=O)COCCc1nn[nH]n1 |
| InChI | InChI=1S/C9H21N.C6H11N5O2.C2H6/c1-5-10(6-2)8-7-9(3)4;1-7-6(12)4-13-3-2-5-8-10-11-9-5;1-2/h9H,5-8H2,1-4H3;2-4H2,1H3,(H,7,12)(H,8,9,10,11);1-2H3 |
| InChIKey | QJULNVMJTXDIJL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|