C19H36N8O2 — CID 22737232
5-[5-[3-[4,4-dimethyl-5-(2H-tetrazol-5-yl)pentoxy]propoxy]-2,2-dimethylpentyl]-2H-tetrazole (PubChem CID 22737232) has the molecular formula C19H36N8O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 5-[5-[3-[4,4-dimethyl-5-(2H-tetrazol-5-yl)pentoxy]propoxy]-2,2-dimethylpentyl]-2H-tetrazole.
| Compound Name | 5-[5-[3-[4,4-dimethyl-5-(2H-tetrazol-5-yl)pentoxy]propoxy]-2,2-dimethylpentyl]-2H-tetrazole |
|---|---|
| PubChem CID | 22737232 |
| Molecular Formula | C19H36N8O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 5-[5-[3-[4,4-dimethyl-5-(2H-tetrazol-5-yl)pentoxy]propoxy]-2,2-dimethylpentyl]-2H-tetrazole |
| SMILES | CC(C)(CCCOCCCOCCCC(C)(C)Cc1nn[nH]n1)Cc1nn[nH]n1 |
| InChI | InChI=1S/C19H36N8O2/c1-18(2,14-16-20-24-25-21-16)8-5-10-28-12-7-13-29-11-6-9-19(3,4)15-17-22-26-27-23-17/h5-15H2,1-4H3,(H,20,21,24,25)(H,22,23,26,27) |
| InChIKey | KAHMRLDFGCLXBT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|