C16H30N8O2 — CID 22737258
5-[1-[2-[3,3-dimethyl-4-(2H-tetrazol-5-yl)butoxy]ethoxy]-3,3-dimethylbutyl]-2H-tetrazole (PubChem CID 22737258) has the molecular formula C16H30N8O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 5-[1-[2-[3,3-dimethyl-4-(2H-tetrazol-5-yl)butoxy]ethoxy]-3,3-dimethylbutyl]-2H-tetrazole.
| Compound Name | 5-[1-[2-[3,3-dimethyl-4-(2H-tetrazol-5-yl)butoxy]ethoxy]-3,3-dimethylbutyl]-2H-tetrazole |
|---|---|
| PubChem CID | 22737258 |
| Molecular Formula | C16H30N8O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 5-[1-[2-[3,3-dimethyl-4-(2H-tetrazol-5-yl)butoxy]ethoxy]-3,3-dimethylbutyl]-2H-tetrazole |
| SMILES | CC(C)(C)CC(OCCOCCC(C)(C)Cc1nn[nH]n1)c1nn[nH]n1 |
| InChI | InChI=1S/C16H30N8O2/c1-15(2,3)10-12(14-19-23-24-20-14)26-9-8-25-7-6-16(4,5)11-13-17-21-22-18-13/h12H,6-11H2,1-5H3,(H,17,18,21,22)(H,19,20,23,24) |
| InChIKey | RFLRVDKLNSJZDZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|