C17H11Cl2F3O2 — CID 143723820
(E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]prop-2-en-1-one (PubChem CID 143723820) has the molecular formula C17H11Cl2F3O2 and a molecular weight of 375.17 g/mol. Its IUPAC name is (E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 143723820 |
| Molecular Formula | C17H11Cl2F3O2 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | (E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-(1,1-difluoroethyl)-5-fluorophenyl]prop-2-en-1-one |
| SMILES | CC(F)(F)c1cc(F)cc(C(=O)/C=C/c2ccc(O)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H11Cl2F3O2/c1-17(21,22)11-6-10(7-12(20)8-11)13(23)4-2-9-3-5-14(24)16(19)15(9)18/h2-8,24H,1H3/b4-2+ |
| InChIKey | PXRLYUPVDYVXOX-DUXPYHPUSA-N |
| XLogP | 5.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|