C17H10Cl2F2O2 — CID 89260284
(E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-fluoro-5-(1-fluoroethenyl)phenyl]prop-2-en-1-one (PubChem CID 89260284) has the molecular formula C17H10Cl2F2O2 and a molecular weight of 355.17 g/mol. Its IUPAC name is (E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-fluoro-5-(1-fluoroethenyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-fluoro-5-(1-fluoroethenyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 89260284 |
| Molecular Formula | C17H10Cl2F2O2 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | (E)-3-(2,3-dichloro-4-hydroxyphenyl)-1-[3-fluoro-5-(1-fluoroethenyl)phenyl]prop-2-en-1-one |
| SMILES | C=C(F)c1cc(F)cc(C(=O)/C=C/c2ccc(O)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H10Cl2F2O2/c1-9(20)11-6-12(8-13(21)7-11)14(22)4-2-10-3-5-15(23)17(19)16(10)18/h2-8,23H,1H2/b4-2+ |
| InChIKey | PLMBVRTULJQRME-DUXPYHPUSA-N |
| XLogP | 5.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|