About ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde
ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde (PubChem CID 143726042) has the molecular formula C15H31FO5
and a molecular weight of 310.41 g/mol. Its IUPAC name is ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde.
Molecular Properties
| Compound Name | ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde |
| PubChem CID | 143726042 |
| Molecular Formula | C15H31FO5 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde |
| SMILES | C=O.CC.CC.CC.CC(=O)OCC1OC(=O)C(F)C1C |
| InChI | InChI=1S/C8H11FO4.3C2H6.CH2O/c1-4-6(3-12-5(2)10)13-8(11)7(4)9;4*1-2/h4,6-7H,3H2,1-2H3;3*1-2H3;1H2 |
| InChIKey | NZXSKGSPRMBKCL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde?
The IUPAC name of ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde (CID 143726042) is ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde.
What is the SMILES notation for ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde?
The canonical SMILES for ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde is C=O.CC.CC.CC.CC(=O)OCC1OC(=O)C(F)C1C.
What is the InChIKey of ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde?
The InChIKey is NZXSKGSPRMBKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FO4.3C2H6.CH2O/c1-4-6(3-12-5(2)10)13-8(11)7(4)9;4*1-2/h4,6-7H,3H2,1-2H3;3*1-2H3;1H2.
What are the key properties of ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde?
ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde has a molecular weight of 310.41 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-fluoro-3-methyl-5-oxooxolan-2-yl)methyl acetate;formaldehyde is sourced from PubChem (CID 143726042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).