C21H21N5O3S — CID 143728241
methyl 4-[[3-[4-(2-aminopyrimidin-4-yl)sulfanylanilino]-3-oxopropyl]amino]benzoate (PubChem CID 143728241) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is methyl 4-[[3-[4-(2-aminopyrimidin-4-yl)sulfanylanilino]-3-oxopropyl]amino]benzoate.
| Compound Name | methyl 4-[[3-[4-(2-aminopyrimidin-4-yl)sulfanylanilino]-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 143728241 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | methyl 4-[[3-[4-(2-aminopyrimidin-4-yl)sulfanylanilino]-3-oxopropyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NCCC(=O)Nc2ccc(Sc3ccnc(N)n3)cc2)cc1 |
| InChI | InChI=1S/C21H21N5O3S/c1-29-20(28)14-2-4-15(5-3-14)23-12-10-18(27)25-16-6-8-17(9-7-16)30-19-11-13-24-21(22)26-19/h2-9,11,13,23H,10,12H2,1H3,(H,25,27)(H2,22,24,26) |
| InChIKey | BDXVKPIMMKIQOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |