C12H17NO3 — CID 143728698
(1S,2R,5S,6R,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one (PubChem CID 143728698) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one.
| Compound Name | (1S,2R,5S,6R,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one |
|---|---|
| PubChem CID | 143728698 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (1S,2R,5S,6R,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-4-one |
| SMILES | CC(=O)[C@@H]1[C@@H]2C(=O)N[C@H](C)[C@]23CC[C@@]1(C)O3 |
| InChI | InChI=1S/C12H17NO3/c1-6(14)8-9-10(15)13-7(2)12(9)5-4-11(8,3)16-12/h7-9H,4-5H2,1-3H3,(H,13,15)/t7-,8-,9-,11-,12-/m1/s1 |
| InChIKey | TZTXBMPUPRYDAR-VFWMFTPISA-N |
| XLogP | 0.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |