C13H15F2NO — CID 143728750
4-(2,5-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole (PubChem CID 143728750) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole.
| Compound Name | 4-(2,5-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 143728750 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(2,5-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole |
| SMILES | CCCC1=NC(C)(c2cc(F)ccc2F)CO1 |
| InChI | InChI=1S/C13H15F2NO/c1-3-4-12-16-13(2,8-17-12)10-7-9(14)5-6-11(10)15/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | RRQDQFFSIPOYSA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |