C8H12N2 — CID 143729063
N,4-dimethyl-4H-azepin-2-amine (PubChem CID 143729063) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N,4-dimethyl-4H-azepin-2-amine.
| Compound Name | N,4-dimethyl-4H-azepin-2-amine |
|---|---|
| PubChem CID | 143729063 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N,4-dimethyl-4H-azepin-2-amine |
| SMILES | CNC1=CC(C)C=CC=N1 |
| InChI | InChI=1S/C8H12N2/c1-7-4-3-5-10-8(6-7)9-2/h3-7,9H,1-2H3 |
| InChIKey | KQMHUFSNWIDPAX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |