About ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene
ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene (PubChem CID 143729265) has the molecular formula C17H30O3
and a molecular weight of 282.42 g/mol. Its IUPAC name is ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene.
Molecular Properties
| Compound Name | ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene |
| PubChem CID | 143729265 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene |
| SMILES | CC.COCC1(C)COCOC1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C7H14O3.C2H6/c1-7-3-5-8(2)6-4-7;1-7(3-8-2)4-9-6-10-5-7;1-2/h3-6H,1-2H3;3-6H2,1-2H3;1-2H3 |
| InChIKey | HHTKVLJUVOFIRI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene?
The IUPAC name of ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene (CID 143729265) is ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene.
What is the SMILES notation for ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene?
The canonical SMILES for ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene is CC.COCC1(C)COCOC1.Cc1ccc(C)cc1.
What is the InChIKey of ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene?
The InChIKey is HHTKVLJUVOFIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C7H14O3.C2H6/c1-7-3-5-8(2)6-4-7;1-7(3-8-2)4-9-6-10-5-7;1-2/h3-6H,1-2H3;3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene?
ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene has a molecular weight of 282.42 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-(methoxymethyl)-5-methyl-1,3-dioxane;1,4-xylene is sourced from PubChem (CID 143729265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).