C20H30I2N2O4 — CID 143729659
2-iodo-N-(6-iodopiperidin-3-yl)-4-methoxy-5-(3-methoxypropoxy)-N-propan-2-ylbenzamide (PubChem CID 143729659) has the molecular formula C20H30I2N2O4 and a molecular weight of 616.28 g/mol. Its IUPAC name is 2-iodo-N-(6-iodopiperidin-3-yl)-4-methoxy-5-(3-methoxypropoxy)-N-propan-2-ylbenzamide.
| Compound Name | 2-iodo-N-(6-iodopiperidin-3-yl)-4-methoxy-5-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 143729659 |
| Molecular Formula | C20H30I2N2O4 |
| Molecular Weight | 616.28 g/mol |
| Exact Mass | 616.03 |
| IUPAC Name | 2-iodo-N-(6-iodopiperidin-3-yl)-4-methoxy-5-(3-methoxypropoxy)-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)C2CCC(I)NC2)c(I)cc1OC |
| InChI | InChI=1S/C20H30I2N2O4/c1-13(2)24(14-6-7-19(22)23-12-14)20(25)15-10-18(28-9-5-8-26-3)17(27-4)11-16(15)21/h10-11,13-14,19,23H,5-9,12H2,1-4H3 |
| InChIKey | NLKLXVOHFIQRBX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|