C13H22FN3O2 — CID 143730587
butan-1-amine;2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide (PubChem CID 143730587) has the molecular formula C13H22FN3O2 and a molecular weight of 271.34 g/mol. Its IUPAC name is butan-1-amine;2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide.
| Compound Name | butan-1-amine;2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 143730587 |
| Molecular Formula | C13H22FN3O2 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | butan-1-amine;2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide |
| SMILES | CCCCN.Cc1cc(NCC(=O)NO)ccc1F |
| InChI | InChI=1S/C9H11FN2O2.C4H11N/c1-6-4-7(2-3-8(6)10)11-5-9(13)12-14;1-2-3-4-5/h2-4,11,14H,5H2,1H3,(H,12,13);2-5H2,1H3 |
| InChIKey | NOONDNQJFOGSRS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|