C22H30F2N2O3 — CID 143730619
4-(butoxymethyl)-1-fluoro-2-methylbenzene;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide (PubChem CID 143730619) has the molecular formula C22H30F2N2O3 and a molecular weight of 408.49 g/mol. Its IUPAC name is 4-(butoxymethyl)-1-fluoro-2-methylbenzene;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide.
| Compound Name | 4-(butoxymethyl)-1-fluoro-2-methylbenzene;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 143730619 |
| Molecular Formula | C22H30F2N2O3 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-(butoxymethyl)-1-fluoro-2-methylbenzene;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide |
| SMILES | CCCCOCc1ccc(F)c(C)c1.Cc1cc(NCC(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C12H17FO.C10H13FN2O2/c1-3-4-7-14-9-11-5-6-12(13)10(2)8-11;1-6-3-8(4-7(2)10(6)11)12-5-9(14)13-15/h5-6,8H,3-4,7,9H2,1-2H3;3-4,12,15H,5H2,1-2H3,(H,13,14) |
| InChIKey | UHKGRWFDGITSNC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|