C20H27FN4O5S — CID 143730600
N-butyl-3-nitrobenzenesulfinamide;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide (PubChem CID 143730600) has the molecular formula C20H27FN4O5S and a molecular weight of 454.52 g/mol. Its IUPAC name is N-butyl-3-nitrobenzenesulfinamide;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide.
| Compound Name | N-butyl-3-nitrobenzenesulfinamide;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 143730600 |
| Molecular Formula | C20H27FN4O5S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-butyl-3-nitrobenzenesulfinamide;2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyacetamide |
| SMILES | CCCCNS(=O)c1cccc([N+](=O)[O-])c1.Cc1cc(NCC(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C10H13FN2O2.C10H14N2O3S/c1-6-3-8(4-7(2)10(6)11)12-5-9(14)13-15;1-2-3-7-11-16(15)10-6-4-5-9(8-10)12(13)14/h3-4,12,15H,5H2,1-2H3,(H,13,14);4-6,8,11H,2-3,7H2,1H3 |
| InChIKey | QFZUSVBTEFVFIT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|