C26H32FN3O2 — CID 143730608
2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide;N-[(3-phenylphenyl)methyl]butan-1-amine (PubChem CID 143730608) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide;N-[(3-phenylphenyl)methyl]butan-1-amine.
| Compound Name | 2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide;N-[(3-phenylphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 143730608 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 2-(4-fluoro-3-methylanilino)-N-hydroxyacetamide;N-[(3-phenylphenyl)methyl]butan-1-amine |
| SMILES | CCCCNCc1cccc(-c2ccccc2)c1.Cc1cc(NCC(=O)NO)ccc1F |
| InChI | InChI=1S/C17H21N.C9H11FN2O2/c1-2-3-12-18-14-15-8-7-11-17(13-15)16-9-5-4-6-10-16;1-6-4-7(2-3-8(6)10)11-5-9(13)12-14/h4-11,13,18H,2-3,12,14H2,1H3;2-4,11,14H,5H2,1H3,(H,12,13) |
| InChIKey | XXNRIVCSLAALRU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|