C14H28OS — CID 143730777
ethane;2-(ethoxymethyl)-4,4-dimethylthiopyran (PubChem CID 143730777) has the molecular formula C14H28OS and a molecular weight of 244.44 g/mol. Its IUPAC name is ethane;2-(ethoxymethyl)-4,4-dimethylthiopyran.
| Compound Name | ethane;2-(ethoxymethyl)-4,4-dimethylthiopyran |
|---|---|
| PubChem CID | 143730777 |
| Molecular Formula | C14H28OS |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | ethane;2-(ethoxymethyl)-4,4-dimethylthiopyran |
| SMILES | CC.CC.CCOCC1=CC(C)(C)C=CS1 |
| InChI | InChI=1S/C10H16OS.2C2H6/c1-4-11-8-9-7-10(2,3)5-6-12-9;2*1-2/h5-7H,4,8H2,1-3H3;2*1-2H3 |
| InChIKey | UJXHIZCMUXPLEF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |