C23H45N5O6 — CID 143730819
acetamide;tert-butyl N-[3-[bis[2-(butylamino)-2-oxoethyl]amino]-3-oxopropyl]-N-methylcarbamate (PubChem CID 143730819) has the molecular formula C23H45N5O6 and a molecular weight of 487.64 g/mol. Its IUPAC name is acetamide;tert-butyl N-[3-[bis[2-(butylamino)-2-oxoethyl]amino]-3-oxopropyl]-N-methylcarbamate.
| Compound Name | acetamide;tert-butyl N-[3-[bis[2-(butylamino)-2-oxoethyl]amino]-3-oxopropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143730819 |
| Molecular Formula | C23H45N5O6 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.34 |
| IUPAC Name | acetamide;tert-butyl N-[3-[bis[2-(butylamino)-2-oxoethyl]amino]-3-oxopropyl]-N-methylcarbamate |
| SMILES | CC(N)=O.CCCCNC(=O)CN(CC(=O)NCCCC)C(=O)CCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H40N4O5.C2H5NO/c1-7-9-12-22-17(26)15-25(16-18(27)23-13-10-8-2)19(28)11-14-24(6)20(29)30-21(3,4)5;1-2(3)4/h7-16H2,1-6H3,(H,22,26)(H,23,27);1H3,(H2,3,4) |
| InChIKey | JMTLJVXVXUYNDE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|