C26H31F2N5O3 — CID 143731414
4-cyclohexylpiperazin-2-one;4-(2,5-difluoro-3-methylanilino)-7-methoxyquinazolin-6-ol (PubChem CID 143731414) has the molecular formula C26H31F2N5O3 and a molecular weight of 499.56 g/mol. Its IUPAC name is 4-cyclohexylpiperazin-2-one;4-(2,5-difluoro-3-methylanilino)-7-methoxyquinazolin-6-ol.
| Compound Name | 4-cyclohexylpiperazin-2-one;4-(2,5-difluoro-3-methylanilino)-7-methoxyquinazolin-6-ol |
|---|---|
| PubChem CID | 143731414 |
| Molecular Formula | C26H31F2N5O3 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 4-cyclohexylpiperazin-2-one;4-(2,5-difluoro-3-methylanilino)-7-methoxyquinazolin-6-ol |
| SMILES | COc1cc2ncnc(Nc3cc(F)cc(C)c3F)c2cc1O.O=C1CN(C2CCCCC2)CCN1 |
| InChI | InChI=1S/C16H13F2N3O2.C10H18N2O/c1-8-3-9(17)4-12(15(8)18)21-16-10-5-13(22)14(23-2)6-11(10)19-7-20-16;13-10-8-12(7-6-11-10)9-4-2-1-3-5-9/h3-7,22H,1-2H3,(H,19,20,21);9H,1-8H2,(H,11,13) |
| InChIKey | OOIMHPHQNDJVGB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |