C4H6F3N — CID 143731623
1,3,3-trifluoropyrrolidine (PubChem CID 143731623) has the molecular formula C4H6F3N and a molecular weight of 125.09 g/mol. Its IUPAC name is 1,3,3-trifluoropyrrolidine.
| Compound Name | 1,3,3-trifluoropyrrolidine |
|---|---|
| PubChem CID | 143731623 |
| Molecular Formula | C4H6F3N |
| Molecular Weight | 125.09 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 1,3,3-trifluoropyrrolidine |
| SMILES | FN1CCC(F)(F)C1 |
| InChI | InChI=1S/C4H6F3N/c5-4(6)1-2-8(7)3-4/h1-3H2 |
| InChIKey | NRDIIYCTRMOSGQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.09 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|