C13H25N — CID 143731926
(Z)-N-methyl-6-[(1R)-2-propylcyclopropyl]hex-5-en-1-amine (PubChem CID 143731926) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (Z)-N-methyl-6-[(1R)-2-propylcyclopropyl]hex-5-en-1-amine.
| Compound Name | (Z)-N-methyl-6-[(1R)-2-propylcyclopropyl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 143731926 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (Z)-N-methyl-6-[(1R)-2-propylcyclopropyl]hex-5-en-1-amine |
| SMILES | CCCC1C[C@H]1/C=C\CCCCNC |
| InChI | InChI=1S/C13H25N/c1-3-8-12-11-13(12)9-6-4-5-7-10-14-2/h6,9,12-14H,3-5,7-8,10-11H2,1-2H3/b9-6-/t12?,13-/m1/s1 |
| InChIKey | RAQPHKBNBIFDMY-SRLWBGMSSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|