C24H40N2O6 — CID 143731978
cis-ethyl (1S,2S)-2-[(Z)-6-[[(1R,2R,4R)-2-carbamoyl-4-(ethoxymethoxy)cyclopentanecarbonyl]-methylamino]hex-1-enyl]-1-methylcyclopropane-1-carboxylate (PubChem CID 143731978) has the molecular formula C24H40N2O6 and a molecular weight of 452.59 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-2-[(Z)-6-[[(1R,2R,4R)-2-carbamoyl-4-(ethoxymethoxy)cyclopentanecarbonyl]-methylamino]hex-1-enyl]-1-methylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2S)-2-[(Z)-6-[[(1R,2R,4R)-2-carbamoyl-4-(ethoxymethoxy)cyclopentanecarbonyl]-methylamino]hex-1-enyl]-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 143731978 |
| Molecular Formula | C24H40N2O6 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | cis-ethyl (1S,2S)-2-[(Z)-6-[[(1R,2R,4R)-2-carbamoyl-4-(ethoxymethoxy)cyclopentanecarbonyl]-methylamino]hex-1-enyl]-1-methylcyclopropane-1-carboxylate |
| SMILES | CCOCO[C@@H]1C[C@@H](C(N)=O)[C@H](C(=O)N(C)CCCC/C=C\[C@@H]2C[C@]2(C)C(=O)OCC)C1 |
| InChI | InChI=1S/C24H40N2O6/c1-5-30-16-32-18-13-19(21(25)27)20(14-18)22(28)26(4)12-10-8-7-9-11-17-15-24(17,3)23(29)31-6-2/h9,11,17-20H,5-8,10,12-16H2,1-4H3,(H2,25,27)/b11-9-/t17-,18-,19-,20-,24+/m1/s1 |
| InChIKey | LHNNVYGNYLZHLO-WXNYHGLISA-N |
| XLogP | 2.65 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|