C20H27FN8O2 — CID 143732556
(3,6-dimethyl-1,4-diazabicyclo[4.1.0]heptan-4-yl)-[3-[[5-fluoro-2-(hydroxymethyl)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]methanone (PubChem CID 143732556) has the molecular formula C20H27FN8O2 and a molecular weight of 430.49 g/mol. Its IUPAC name is (3,6-dimethyl-1,4-diazabicyclo[4.1.0]heptan-4-yl)-[3-[[5-fluoro-2-(hydroxymethyl)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]methanone.
| Compound Name | (3,6-dimethyl-1,4-diazabicyclo[4.1.0]heptan-4-yl)-[3-[[5-fluoro-2-(hydroxymethyl)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 143732556 |
| Molecular Formula | C20H27FN8O2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (3,6-dimethyl-1,4-diazabicyclo[4.1.0]heptan-4-yl)-[3-[[5-fluoro-2-(hydroxymethyl)pyrimidin-4-yl]amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]methanone |
| SMILES | CC1CN2CC2(C)CN1C(=O)N1Cc2c(Nc3nc(CO)ncc3F)n[nH]c2C1(C)C |
| InChI | InChI=1S/C20H27FN8O2/c1-11-6-27-9-20(27,4)10-28(11)18(31)29-7-12-15(19(29,2)3)25-26-16(12)24-17-13(21)5-22-14(8-30)23-17/h5,11,30H,6-10H2,1-4H3,(H2,22,23,24,25,26) |
| InChIKey | VGPLYQREKUKFMC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|